C18H19NO2 — CID 100959524
N-benzyl-N-[(2R,3R)-2-phenyloxetan-3-yl]acetamide (PubChem CID 100959524) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-benzyl-N-[(2R,3R)-2-phenyloxetan-3-yl]acetamide.
| Compound Name | N-benzyl-N-[(2R,3R)-2-phenyloxetan-3-yl]acetamide |
|---|---|
| PubChem CID | 100959524 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-benzyl-N-[(2R,3R)-2-phenyloxetan-3-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)[C@@H]1CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-14(20)19(12-15-8-4-2-5-9-15)17-13-21-18(17)16-10-6-3-7-11-16/h2-11,17-18H,12-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | WBWLLAQVAXPMFK-QZTJIDSGSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |