C32H50O8 — CID 100959883
(2E,6E,20E)-13,14,17-trihydroxy-11-(hydroxymethyl)-7,12,19,20,24-pentamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione (PubChem CID 100959883) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is (2E,6E,20E)-13,14,17-trihydroxy-11-(hydroxymethyl)-7,12,19,20,24-pentamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione.
| Compound Name | (2E,6E,20E)-13,14,17-trihydroxy-11-(hydroxymethyl)-7,12,19,20,24-pentamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione |
|---|---|
| PubChem CID | 100959883 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (2E,6E,20E)-13,14,17-trihydroxy-11-(hydroxymethyl)-7,12,19,20,24-pentamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione |
| SMILES | C=C1/C=C(\C)C(C)CC(O)CC(=O)C(O)C(O)C(C)C(CO)COC(=O)/C(C)=C/CC/C=C/C2OC2CC(C)C1 |
| InChI | InChI=1S/C32H50O8/c1-19-12-20(2)14-29-28(40-29)11-9-7-8-10-21(3)32(38)39-18-25(17-33)24(6)30(36)31(37)27(35)16-26(34)15-23(5)22(4)13-19/h9-11,13,20,23-26,28-31,33-34,36-37H,1,7-8,12,14-18H2,2-6H3/b11-9+,21-10+,22-13+ |
| InChIKey | SSGFSLNVBOCQPW-SSDFMNQPSA-N |
| XLogP | 3.82 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|