C42H63N3O6 — CID 100959970
5,8-bis[[(1R,4R)-3-(2,2-dimethylpropoxy)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-phenyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 100959970) has the molecular formula C42H63N3O6 and a molecular weight of 705.98 g/mol. Its IUPAC name is 5,8-bis[[(1R,4R)-3-(2,2-dimethylpropoxy)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-phenyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 5,8-bis[[(1R,4R)-3-(2,2-dimethylpropoxy)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-phenyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 100959970 |
| Molecular Formula | C42H63N3O6 |
| Molecular Weight | 705.98 g/mol |
| Exact Mass | 705.47 |
| IUPAC Name | 5,8-bis[[(1R,4R)-3-(2,2-dimethylpropoxy)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-phenyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | CC(C)(C)COC1C(OC2C=CC(OC3C(OCC(C)(C)C)[C@@H]4CC[C@]3(C)C4(C)C)n3c(=O)n(-c4ccccc4)c(=O)n32)[C@]2(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C42H63N3O6/c1-37(2,3)24-48-31-27-20-22-41(11,39(27,7)8)33(31)50-29-18-19-30(45-36(47)43(35(46)44(29)45)26-16-14-13-15-17-26)51-34-32(49-25-38(4,5)6)28-21-23-42(34,12)40(28,9)10/h13-19,27-34H,20-25H2,1-12H3/t27-,28-,29?,30?,31?,32?,33?,34?,41-,42-/m0/s1 |
| InChIKey | DBSNHMXJSBXRQG-BKDNPOLNSA-N |
| XLogP | 7.91 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.98 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|