C41H54O4 — CID 100960111
bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3aS,5R)-2-methyl-2-phenyl-1,5-dihydroacenaphthylene-3a,5-dicarboxylate (PubChem CID 100960111) has the molecular formula C41H54O4 and a molecular weight of 610.88 g/mol. Its IUPAC name is bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3aS,5R)-2-methyl-2-phenyl-1,5-dihydroacenaphthylene-3a,5-dicarboxylate.
| Compound Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3aS,5R)-2-methyl-2-phenyl-1,5-dihydroacenaphthylene-3a,5-dicarboxylate |
|---|---|
| PubChem CID | 100960111 |
| Molecular Formula | C41H54O4 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.40 |
| IUPAC Name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3aS,5R)-2-methyl-2-phenyl-1,5-dihydroacenaphthylene-3a,5-dicarboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H]1C=C[C@@]2(C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)C)c3c(cccc31)C[C@@]2(C)c1ccccc1 |
| InChI | InChI=1S/C41H54O4/c1-25(2)31-18-16-27(5)22-35(31)44-38(42)34-20-21-41(39(43)45-36-23-28(6)17-19-32(36)26(3)4)37-29(12-11-15-33(34)37)24-40(41,7)30-13-9-8-10-14-30/h8-15,20-21,25-28,31-32,34-36H,16-19,22-24H2,1-7H3/t27-,28-,31+,32+,34-,35-,36-,40+,41+/m1/s1 |
| InChIKey | LFEXQJHGVWTKQP-FSHDOAMVSA-N |
| XLogP | 9.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|