About CID 100960387
CID 100960387 (PubChem CID 100960387) has the molecular formula C15H20NO
and a molecular weight of 230.33 g/mol.
Molecular Properties
| Compound Name | CID 100960387 |
| PubChem CID | 100960387 |
| Molecular Formula | C15H20NO |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | — |
| SMILES | CC1(C)C=C(c2ccccc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C15H20NO/c1-14(2)10-13(11-15(3,4)16(14)17)12-8-6-5-7-9-12/h5-10H,11H2,1-4H3 |
| InChIKey | HAYPWPCAEYZFHV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 100960387 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100960387?
The IUPAC name of CID 100960387 (CID 100960387) is not available.
What is the SMILES notation for CID 100960387?
The canonical SMILES for CID 100960387 is CC1(C)C=C(c2ccccc2)CC(C)(C)N1[O].
What is the InChIKey of CID 100960387?
The InChIKey is HAYPWPCAEYZFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20NO/c1-14(2)10-13(11-15(3,4)16(14)17)12-8-6-5-7-9-12/h5-10H,11H2,1-4H3.
What are the key properties of CID 100960387?
CID 100960387 has a molecular weight of 230.33 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100960387 is sourced from PubChem (CID 100960387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).