C28H34ClN2S+ — CID 10096059
(4-tert-butylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium (PubChem CID 10096059) has the molecular formula C28H34ClN2S+ and a molecular weight of 466.11 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium.
| Compound Name | (4-tert-butylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 10096059 |
| Molecular Formula | C28H34ClN2S+ |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[3-(2-chlorophenothiazin-10-yl)propyl]-dimethylazanium |
| SMILES | CC(C)(C)c1ccc(C[N+](C)(C)CCCN2c3ccccc3Sc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C28H34ClN2S/c1-28(2,3)22-13-11-21(12-14-22)20-31(4,5)18-8-17-30-24-9-6-7-10-26(24)32-27-16-15-23(29)19-25(27)30/h6-7,9-16,19H,8,17-18,20H2,1-5H3/q+1 |
| InChIKey | XKNWWXYUMFBFGI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|