C28H25Cl2NO5 — CID 100960621
ethyl (3aS,6aS)-5-benzyl-2,2-bis(4-chlorophenyl)-6a-hydroxy-4-oxo-3,6-dihydrofuro[2,3-c]pyrrole-3a-carboxylate (PubChem CID 100960621) has the molecular formula C28H25Cl2NO5 and a molecular weight of 526.42 g/mol. Its IUPAC name is ethyl (3aS,6aS)-5-benzyl-2,2-bis(4-chlorophenyl)-6a-hydroxy-4-oxo-3,6-dihydrofuro[2,3-c]pyrrole-3a-carboxylate.
| Compound Name | ethyl (3aS,6aS)-5-benzyl-2,2-bis(4-chlorophenyl)-6a-hydroxy-4-oxo-3,6-dihydrofuro[2,3-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 100960621 |
| Molecular Formula | C28H25Cl2NO5 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | ethyl (3aS,6aS)-5-benzyl-2,2-bis(4-chlorophenyl)-6a-hydroxy-4-oxo-3,6-dihydrofuro[2,3-c]pyrrole-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)O[C@]1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C28H25Cl2NO5/c1-2-35-25(33)26-17-27(20-8-12-22(29)13-9-20,21-10-14-23(30)15-11-21)36-28(26,34)18-31(24(26)32)16-19-6-4-3-5-7-19/h3-15,34H,2,16-18H2,1H3/t26-,28+/m0/s1 |
| InChIKey | WPIHTKHJBZDLQN-XTEPFMGCSA-N |
| XLogP | 4.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|