C28H25F2NO5 — CID 100960731
ethyl 6-benzyl-3,3-bis(4-fluorophenyl)-7-oxo-5,7a-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 100960731) has the molecular formula C28H25F2NO5 and a molecular weight of 493.51 g/mol. Its IUPAC name is ethyl 6-benzyl-3,3-bis(4-fluorophenyl)-7-oxo-5,7a-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl 6-benzyl-3,3-bis(4-fluorophenyl)-7-oxo-5,7a-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 100960731 |
| Molecular Formula | C28H25F2NO5 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | ethyl 6-benzyl-3,3-bis(4-fluorophenyl)-7-oxo-5,7a-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)C12CN(Cc3ccccc3)C(=O)C1OOC(c1ccc(F)cc1)(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C28H25F2NO5/c1-2-34-26(33)27-17-28(20-8-12-22(29)13-9-20,21-10-14-23(30)15-11-21)36-35-24(27)25(32)31(18-27)16-19-6-4-3-5-7-19/h3-15,24H,2,16-18H2,1H3 |
| InChIKey | VBDYNUILBUMIQC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|