C13H24BIO3 — CID 100960975
2-[(S)-iodo-[(2S)-6-methyloxan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 100960975) has the molecular formula C13H24BIO3 and a molecular weight of 366.05 g/mol. Its IUPAC name is 2-[(S)-iodo-[(2S)-6-methyloxan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(S)-iodo-[(2S)-6-methyloxan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 100960975 |
| Molecular Formula | C13H24BIO3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[(S)-iodo-[(2S)-6-methyloxan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CCC[C@@H]([C@@H](I)B2OC(C)(C)C(C)(C)O2)O1 |
| InChI | InChI=1S/C13H24BIO3/c1-9-7-6-8-10(16-9)11(15)14-17-12(2,3)13(4,5)18-14/h9-11H,6-8H2,1-5H3/t9?,10-,11+/m0/s1 |
| InChIKey | AQQHRUCWWJFCCE-QXXIUIOUSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|