C34H66O6S3Sn — CID 100961
Nonanoic acid, 1,1',1''-[(methylstannylidyne)tris(thio-2,1-ethanediyl)] ester (PubChem CID 100961) has the molecular formula C34H66O6S3Sn and a molecular weight of 785.80 g/mol. Its IUPAC name is 2-[methyl-bis(2-nonanoyloxyethylsulfanyl)stannyl]sulfanylethyl nonanoate.
| Compound Name | Nonanoic acid, 1,1',1''-[(methylstannylidyne)tris(thio-2,1-ethanediyl)] ester |
|---|---|
| PubChem CID | 100961 |
| Molecular Formula | C34H66O6S3Sn |
| Molecular Weight | 785.80 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | 2-[methyl-bis(2-nonanoyloxyethylsulfanyl)stannyl]sulfanylethyl nonanoate |
| SMILES | CCCCCCCCC(=O)OCCS[Sn](C)(SCCOC(=O)CCCCCCCC)SCCOC(=O)CCCCCCCC |
| InChI | InChI=1S/3C11H22O2S.CH3.Sn/c3*1-2-3-4-5-6-7-8-11(12)13-9-10-14;;/h3*14H,2-10H2,1H3;1H3;/q;;;;+3/p-3 |
| InChIKey | OMEJTPMPMHOZBW-UHFFFAOYSA-K |
| XLogP | — |
| TPSA | 155.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | 610 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|