C18H37NO2 — CID 100961122
(2S,3S,6R)-6-(12-hydroxydodecyl)-2-methylpiperidin-3-ol (PubChem CID 100961122) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is (2S,3S,6R)-6-(12-hydroxydodecyl)-2-methylpiperidin-3-ol.
| Compound Name | (2S,3S,6R)-6-(12-hydroxydodecyl)-2-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 100961122 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | (2S,3S,6R)-6-(12-hydroxydodecyl)-2-methylpiperidin-3-ol |
| SMILES | C[C@@H]1N[C@H](CCCCCCCCCCCCO)CC[C@@H]1O |
| InChI | InChI=1S/C18H37NO2/c1-16-18(21)14-13-17(19-16)12-10-8-6-4-2-3-5-7-9-11-15-20/h16-21H,2-15H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | MKFVHOZHTXBXCX-KSZLIROESA-N |
| XLogP | 3.77 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|