C18H24F3N3O6S — CID 10096121
N-hydroxy-4-[4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 10096121) has the molecular formula C18H24F3N3O6S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10096121 |
| Molecular Formula | C18H24F3N3O6S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-hydroxy-4-[4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(OCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H24F3N3O6S/c19-18(20,21)12-30-14-1-2-15(22-11-14)13-3-7-24(8-4-13)31(27,28)17(16(25)23-26)5-9-29-10-6-17/h1-2,11,13,26H,3-10,12H2,(H,23,25) |
| InChIKey | PHVLANGQUUEXSS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|