C16H17NO4 — CID 100961584
(1R,2R,6S,7S,8S,9R)-8,9-dihydroxy-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 100961584) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,9R)-8,9-dihydroxy-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,9R)-8,9-dihydroxy-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 100961584 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (1R,2R,6S,7S,8S,9R)-8,9-dihydroxy-4-(2-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2[C@H]3C[C@H]([C@H](O)[C@@H]3O)[C@@H]2C1=O |
| InChI | InChI=1S/C16H17NO4/c1-7-4-2-3-5-10(7)17-15(20)11-8-6-9(12(11)16(17)21)14(19)13(8)18/h2-5,8-9,11-14,18-19H,6H2,1H3/t8-,9+,11-,12+,13-,14+ |
| InChIKey | ZPQDPMQXAFJEOO-DVAYIVIVSA-N |
| XLogP | 0.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|