About (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane
(2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane (PubChem CID 100961601) has the molecular formula C14H30S2Si
and a molecular weight of 290.61 g/mol. Its IUPAC name is (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane |
| PubChem CID | 100961601 |
| Molecular Formula | C14H30S2Si |
| Molecular Weight | 290.61 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C1(C)SCCCS1 |
| InChI | InChI=1S/C14H30S2Si/c1-11(2)17(12(3)4,13(5)6)14(7)15-9-8-10-16-14/h11-13H,8-10H2,1-7H3 |
| InChIKey | SJOYTSRQSKIYQP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane?
The IUPAC name of (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane (CID 100961601) is (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane.
What is the SMILES notation for (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane?
The canonical SMILES for (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is CC(C)[Si](C(C)C)(C(C)C)C1(C)SCCCS1.
What is the InChIKey of (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane?
The InChIKey is SJOYTSRQSKIYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30S2Si/c1-11(2)17(12(3)4,13(5)6)14(7)15-9-8-10-16-14/h11-13H,8-10H2,1-7H3.
What are the key properties of (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane?
(2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane has a molecular weight of 290.61 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is sourced from PubChem (CID 100961601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).