C13H20OSSi — CID 100961605
trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane (PubChem CID 100961605) has the molecular formula C13H20OSSi and a molecular weight of 252.45 g/mol. Its IUPAC name is trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane.
| Compound Name | trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane |
|---|---|
| PubChem CID | 100961605 |
| Molecular Formula | C13H20OSSi |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane |
| SMILES | C[Si](C)(C)C1(c2ccccc2)OCCCS1 |
| InChI | InChI=1S/C13H20OSSi/c1-16(2,3)13(14-10-7-11-15-13)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | CVTVQICVMHUOMT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|