About trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane
trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane (PubChem CID 100961605) has the molecular formula C13H20OSSi
and a molecular weight of 252.45 g/mol. Its IUPAC name is trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane.
Molecular Properties
| Compound Name | trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane |
| PubChem CID | 100961605 |
| Molecular Formula | C13H20OSSi |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane |
| SMILES | C[Si](C)(C)C1(c2ccccc2)OCCCS1 |
| InChI | InChI=1S/C13H20OSSi/c1-16(2,3)13(14-10-7-11-15-13)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | CVTVQICVMHUOMT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane?
The IUPAC name of trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane (CID 100961605) is trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane.
What is the SMILES notation for trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane?
The canonical SMILES for trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane is C[Si](C)(C)C1(c2ccccc2)OCCCS1.
What is the InChIKey of trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane?
The InChIKey is CVTVQICVMHUOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20OSSi/c1-16(2,3)13(14-10-7-11-15-13)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3.
What are the key properties of trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane?
trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane has a molecular weight of 252.45 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2-phenyl-1,3-oxathian-2-yl)silane is sourced from PubChem (CID 100961605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).