C42H49N5O2 — CID 100962403
2,3,7,8,12,13,17,18-octaethyl-15-(2-nitrophenyl)-21,22-dihydroporphyrin (PubChem CID 100962403) has the molecular formula C42H49N5O2 and a molecular weight of 655.89 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-15-(2-nitrophenyl)-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-15-(2-nitrophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 100962403 |
| Molecular Formula | C42H49N5O2 |
| Molecular Weight | 655.89 g/mol |
| Exact Mass | 655.39 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-15-(2-nitrophenyl)-21,22-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2-c2ccccc2[N+](=O)[O-])C(CC)=C4CC)c(CC)c3CC)c(CC)c1CC |
| InChI | InChI=1S/C42H49N5O2/c1-9-24-26(11-3)35-22-37-28(13-5)30(15-7)41(45-37)40(32-19-17-18-20-39(32)47(48)49)42-31(16-8)29(14-6)38(46-42)23-36-27(12-4)25(10-2)34(44-36)21-33(24)43-35/h17-23,43-44H,9-16H2,1-8H3/b33-21-,34-21-,35-22-,36-23-,37-22-,38-23-,41-40-,42-40- |
| InChIKey | SAGFECIWDNFIBB-PFQUHYHNSA-N |
| XLogP | 11.60 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.89 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|