C6H8N4O4 — CID 100962432
(2S,3S,4R,5R)-2-azido-3,4,5-trihydroxyoxane-2-carbonitrile (PubChem CID 100962432) has the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-azido-3,4,5-trihydroxyoxane-2-carbonitrile.
| Compound Name | (2S,3S,4R,5R)-2-azido-3,4,5-trihydroxyoxane-2-carbonitrile |
|---|---|
| PubChem CID | 100962432 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2S,3S,4R,5R)-2-azido-3,4,5-trihydroxyoxane-2-carbonitrile |
| SMILES | N#C[C@]1(N=[N+]=[N-])OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8N4O4/c7-2-6(9-10-8)5(13)4(12)3(11)1-14-6/h3-5,11-13H,1H2/t3-,4-,5+,6+/m1/s1 |
| InChIKey | WLWDHHOMGXEGAG-ZXXMMSQZSA-N |
| XLogP | -1.37 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|