C31H46N2O6Si2 — CID 100962563
(1R,2S,5S,6R,8R)-5-(2,2-diphenylhydrazinyl)-11,11,13,13-tetra(propan-2-yl)-3,7,10,12,14-pentaoxa-11,13-disilatricyclo[6.6.0.02,6]tetradecan-4-one (PubChem CID 100962563) has the molecular formula C31H46N2O6Si2 and a molecular weight of 598.89 g/mol. Its IUPAC name is (1R,2S,5S,6R,8R)-5-(2,2-diphenylhydrazinyl)-11,11,13,13-tetra(propan-2-yl)-3,7,10,12,14-pentaoxa-11,13-disilatricyclo[6.6.0.02,6]tetradecan-4-one.
| Compound Name | (1R,2S,5S,6R,8R)-5-(2,2-diphenylhydrazinyl)-11,11,13,13-tetra(propan-2-yl)-3,7,10,12,14-pentaoxa-11,13-disilatricyclo[6.6.0.02,6]tetradecan-4-one |
|---|---|
| PubChem CID | 100962563 |
| Molecular Formula | C31H46N2O6Si2 |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (1R,2S,5S,6R,8R)-5-(2,2-diphenylhydrazinyl)-11,11,13,13-tetra(propan-2-yl)-3,7,10,12,14-pentaoxa-11,13-disilatricyclo[6.6.0.02,6]tetradecan-4-one |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@H]3[C@H](OC(=O)[C@H]3NN(c3ccccc3)c3ccccc3)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C31H46N2O6Si2/c1-20(2)40(21(3)4)35-19-26-28(38-41(39-40,22(5)6)23(7)8)30-29(36-26)27(31(34)37-30)32-33(24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,20-23,26-30,32H,19H2,1-8H3/t26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | WKOLMPCGSYCRKM-ONBQWJCTSA-N |
| XLogP | 6.35 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|