C23H28N2O6 — CID 100962567
(2R,3S,3aS,6S,6aR)-2-[(1R)-1,2-dimethoxyethyl]-6-(2,2-diphenylhydrazinyl)-3-methoxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 100962567) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2R,3S,3aS,6S,6aR)-2-[(1R)-1,2-dimethoxyethyl]-6-(2,2-diphenylhydrazinyl)-3-methoxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3S,3aS,6S,6aR)-2-[(1R)-1,2-dimethoxyethyl]-6-(2,2-diphenylhydrazinyl)-3-methoxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 100962567 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2R,3S,3aS,6S,6aR)-2-[(1R)-1,2-dimethoxyethyl]-6-(2,2-diphenylhydrazinyl)-3-methoxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | COC[C@@H](OC)[C@H]1O[C@H]2[C@H](OC(=O)[C@H]2NN(c2ccccc2)c2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C23H28N2O6/c1-27-14-17(28-2)19-21(29-3)22-20(30-19)18(23(26)31-22)24-25(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-22,24H,14H2,1-3H3/t17-,18+,19-,20-,21+,22+/m1/s1 |
| InChIKey | GNEDDSWMINOHAR-HJEMKOJISA-N |
| XLogP | 2.07 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|