C11H22O2S2 — CID 100962609
(4R)-4-[2,2-bis(ethylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 100962609) has the molecular formula C11H22O2S2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (4R)-4-[2,2-bis(ethylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[2,2-bis(ethylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 100962609 |
| Molecular Formula | C11H22O2S2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (4R)-4-[2,2-bis(ethylsulfanyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCSC(C[C@@H]1COC(C)(C)O1)SCC |
| InChI | InChI=1S/C11H22O2S2/c1-5-14-10(15-6-2)7-9-8-12-11(3,4)13-9/h9-10H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | ANZQNSJAHRCQCB-SECBINFHSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|