C27H33B2N3O4 — CID 100962747
2,6-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine (PubChem CID 100962747) has the molecular formula C27H33B2N3O4 and a molecular weight of 485.20 g/mol. Its IUPAC name is 2,6-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine.
| Compound Name | 2,6-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 100962747 |
| Molecular Formula | C27H33B2N3O4 |
| Molecular Weight | 485.20 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2,6-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3cccc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cn4)n3)nc2)OC1(C)C |
| InChI | InChI=1S/C27H33B2N3O4/c1-24(2)25(3,4)34-28(33-24)18-12-14-20(30-16-18)22-10-9-11-23(32-22)21-15-13-19(17-31-21)29-35-26(5,6)27(7,8)36-29/h9-17H,1-8H3 |
| InChIKey | RHKKOFDKQQONGU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|