C15H20N2O2 — CID 100963121
(4R,5S)-N,5-dimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 100963121) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (4R,5S)-N,5-dimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | (4R,5S)-N,5-dimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 100963121 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (4R,5S)-N,5-dimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | CNC(=O)[C@@H]1C(c2c(C)cc(C)cc2C)=NO[C@H]1C |
| InChI | InChI=1S/C15H20N2O2/c1-8-6-9(2)12(10(3)7-8)14-13(15(18)16-5)11(4)19-17-14/h6-7,11,13H,1-5H3,(H,16,18)/t11-,13-/m0/s1 |
| InChIKey | FCNUUBPHPNGSCY-AAEUAGOBSA-N |
| XLogP | 2.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |