C16H22N2O2 — CID 100963123
(4R,5S)-N,N,5-trimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 100963123) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4R,5S)-N,N,5-trimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | (4R,5S)-N,N,5-trimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 100963123 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (4R,5S)-N,N,5-trimethyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cc(C)c(C2=NO[C@@H](C)[C@@H]2C(=O)N(C)C)c(C)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-9-7-10(2)13(11(3)8-9)15-14(12(4)20-17-15)16(19)18(5)6/h7-8,12,14H,1-6H3/t12-,14-/m0/s1 |
| InChIKey | HPDISDKZYYIHJW-JSGCOSHPSA-N |
| XLogP | 2.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |