C18H26N2O2 — CID 100963125
(4R,5S)-N,N-diethyl-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 100963125) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (4R,5S)-N,N-diethyl-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | (4R,5S)-N,N-diethyl-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 100963125 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (4R,5S)-N,N-diethyl-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C(c2c(C)cc(C)cc2C)=NO[C@H]1C |
| InChI | InChI=1S/C18H26N2O2/c1-7-20(8-2)18(21)16-14(6)22-19-17(16)15-12(4)9-11(3)10-13(15)5/h9-10,14,16H,7-8H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | QGEVOAURTUKTIX-HOCLYGCPSA-N |
| XLogP | 3.22 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |