C28H24O7 — CID 10096336
(4S,4'aR,5S)-4,5-bis(2-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one (PubChem CID 10096336) has the molecular formula C28H24O7 and a molecular weight of 472.49 g/mol. Its IUPAC name is (4S,4'aR,5S)-4,5-bis(2-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one.
| Compound Name | (4S,4'aR,5S)-4,5-bis(2-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one |
|---|---|
| PubChem CID | 10096336 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (4S,4'aR,5S)-4,5-bis(2-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one |
| SMILES | COc1ccccc1[C@@H]1OC2(C[C@H]3Oc4ccccc4C(=O)C3=CO2)O[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C28H24O7/c1-30-21-12-6-4-10-18(21)26-27(19-11-5-7-13-22(19)31-2)35-28(34-26)15-24-20(16-32-28)25(29)17-9-3-8-14-23(17)33-24/h3-14,16,24,26-27H,15H2,1-2H3/t24-,26+,27+/m1/s1 |
| InChIKey | UKHIPZFLDKUHDV-STXQHDJLSA-N |
| XLogP | 5.13 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |