C14H40Si6 — CID 100963461
dimethyl-[2,4,4-tris(dimethylsilyl)-1,1,3,3-tetramethyl-1,3-disiletan-2-yl]silane (PubChem CID 100963461) has the molecular formula C14H40Si6 and a molecular weight of 376.99 g/mol. Its IUPAC name is dimethyl-[2,4,4-tris(dimethylsilyl)-1,1,3,3-tetramethyl-1,3-disiletan-2-yl]silane.
| Compound Name | dimethyl-[2,4,4-tris(dimethylsilyl)-1,1,3,3-tetramethyl-1,3-disiletan-2-yl]silane |
|---|---|
| PubChem CID | 100963461 |
| Molecular Formula | C14H40Si6 |
| Molecular Weight | 376.99 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | dimethyl-[2,4,4-tris(dimethylsilyl)-1,1,3,3-tetramethyl-1,3-disiletan-2-yl]silane |
| SMILES | C[SiH](C)C1([SiH](C)C)[Si](C)(C)C([SiH](C)C)([SiH](C)C)[Si]1(C)C |
| InChI | InChI=1S/C14H40Si6/c1-15(2)13(16(3)4)19(9,10)14(17(5)6,18(7)8)20(13,11)12/h15-18H,1-12H3 |
| InChIKey | GCCZCOBCOCWLET-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|