About 2-[(4-chlorophenyl)methyl]-1,3-dithiolane
2-[(4-chlorophenyl)methyl]-1,3-dithiolane (PubChem CID 100963578) has the molecular formula C10H11ClS2
and a molecular weight of 230.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methyl]-1,3-dithiolane |
| PubChem CID | 100963578 |
| Molecular Formula | C10H11ClS2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1,3-dithiolane |
| SMILES | Clc1ccc(CC2SCCS2)cc1 |
| InChI | InChI=1S/C10H11ClS2/c11-9-3-1-8(2-4-9)7-10-12-5-6-13-10/h1-4,10H,5-7H2 |
| InChIKey | RUYMFEIFZMGOJE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-chlorophenyl)methyl]-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methyl]-1,3-dithiolane?
The IUPAC name of 2-[(4-chlorophenyl)methyl]-1,3-dithiolane (CID 100963578) is 2-[(4-chlorophenyl)methyl]-1,3-dithiolane.
What is the SMILES notation for 2-[(4-chlorophenyl)methyl]-1,3-dithiolane?
The canonical SMILES for 2-[(4-chlorophenyl)methyl]-1,3-dithiolane is Clc1ccc(CC2SCCS2)cc1.
What is the InChIKey of 2-[(4-chlorophenyl)methyl]-1,3-dithiolane?
The InChIKey is RUYMFEIFZMGOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClS2/c11-9-3-1-8(2-4-9)7-10-12-5-6-13-10/h1-4,10H,5-7H2.
What are the key properties of 2-[(4-chlorophenyl)methyl]-1,3-dithiolane?
2-[(4-chlorophenyl)methyl]-1,3-dithiolane has a molecular weight of 230.78 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methyl]-1,3-dithiolane is sourced from PubChem (CID 100963578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).