C25H18N2O3Se — CID 10096387
19-methyl-19-phenylselanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 10096387) has the molecular formula C25H18N2O3Se and a molecular weight of 473.39 g/mol. Its IUPAC name is 19-methyl-19-phenylselanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | 19-methyl-19-phenylselanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10096387 |
| Molecular Formula | C25H18N2O3Se |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 19-methyl-19-phenylselanyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC1([Se]c2ccccc2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C25H18N2O3Se/c1-25(31-17-8-3-2-4-9-17)19-12-21-22-16(11-15-7-5-6-10-20(15)26-22)13-27(21)23(28)18(19)14-30-24(25)29/h2-12H,13-14H2,1H3 |
| InChIKey | ZVHRMHKIDIVVKF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|