C21H34O4Si2 — CID 100964173
[(2R,3S,6S)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 100964173) has the molecular formula C21H34O4Si2 and a molecular weight of 406.67 g/mol. Its IUPAC name is [(2R,3S,6S)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2R,3S,6S)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 100964173 |
| Molecular Formula | C21H34O4Si2 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(2R,3S,6S)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](C#C[Si](C)(C)C)O[C@@H]1C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O4Si2/c1-17(22)24-20-13-12-18(14-16-26(5,6)7)25-19(20)11-10-15-23-27(8,9)21(2,3)4/h12-13,18-20H,15H2,1-9H3/t18-,19+,20-/m0/s1 |
| InChIKey | FDMOOWIHTWRGTC-ZCNNSNEGSA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|