C12H20F8O6P2 — CID 10096428
1,4-bis(diethoxyphosphoryl)-1,1,2,2,3,3,4,4-octafluorobutane (PubChem CID 10096428) has the molecular formula C12H20F8O6P2 and a molecular weight of 474.22 g/mol. Its IUPAC name is 1,4-bis(diethoxyphosphoryl)-1,1,2,2,3,3,4,4-octafluorobutane.
| Compound Name | 1,4-bis(diethoxyphosphoryl)-1,1,2,2,3,3,4,4-octafluorobutane |
|---|---|
| PubChem CID | 10096428 |
| Molecular Formula | C12H20F8O6P2 |
| Molecular Weight | 474.22 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1,4-bis(diethoxyphosphoryl)-1,1,2,2,3,3,4,4-octafluorobutane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H20F8O6P2/c1-5-23-27(21,24-6-2)11(17,18)9(13,14)10(15,16)12(19,20)28(22,25-7-3)26-8-4/h5-8H2,1-4H3 |
| InChIKey | OCIYAVLIXNJNGM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.22 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|