C18H26BrCl3O3 — CID 100964564
(6S,8R,11S)-2-[(4R)-4-bromo-5,5,5-trichloropentyl]-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 100964564) has the molecular formula C18H26BrCl3O3 and a molecular weight of 476.67 g/mol. Its IUPAC name is (6S,8R,11S)-2-[(4R)-4-bromo-5,5,5-trichloropentyl]-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | (6S,8R,11S)-2-[(4R)-4-bromo-5,5,5-trichloropentyl]-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 100964564 |
| Molecular Formula | C18H26BrCl3O3 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | (6S,8R,11S)-2-[(4R)-4-bromo-5,5,5-trichloropentyl]-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@]12OC(=O)C=C(CCC[C@@H](Br)C(Cl)(Cl)Cl)O2 |
| InChI | InChI=1S/C18H26BrCl3O3/c1-11(2)14-8-7-12(3)10-17(14)24-13(9-16(23)25-17)5-4-6-15(19)18(20,21)22/h9,11-12,14-15H,4-8,10H2,1-3H3/t12-,14+,15-,17+/m1/s1 |
| InChIKey | HODIXEYPWLSXAW-JWDQPFGJSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|