C9H11N3O6S — CID 100965219
methyl (4R)-3-(2-diazo-3-oxobutanoyl)-1,1-dioxo-1,3-thiazolidine-4-carboxylate (PubChem CID 100965219) has the molecular formula C9H11N3O6S and a molecular weight of 289.27 g/mol. Its IUPAC name is methyl (4R)-3-(2-diazo-3-oxobutanoyl)-1,1-dioxo-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4R)-3-(2-diazo-3-oxobutanoyl)-1,1-dioxo-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 100965219 |
| Molecular Formula | C9H11N3O6S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl (4R)-3-(2-diazo-3-oxobutanoyl)-1,1-dioxo-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CS(=O)(=O)CN1C(=O)C(=[N+]=[N-])C(C)=O |
| InChI | InChI=1S/C9H11N3O6S/c1-5(13)7(11-10)8(14)12-4-19(16,17)3-6(12)9(15)18-2/h6H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | OSKDCDBAJXYHOE-LURJTMIESA-N |
| XLogP | -2.00 |
| TPSA | 134.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|