C16H15ClN4O3 — CID 100965290
methyl N-[[(2E)-2-(4-chlorophenyl)-2-(phenylhydrazinylidene)acetyl]amino]carbamate (PubChem CID 100965290) has the molecular formula C16H15ClN4O3 and a molecular weight of 346.77 g/mol. Its IUPAC name is methyl N-[[(2E)-2-(4-chlorophenyl)-2-(phenylhydrazinylidene)acetyl]amino]carbamate.
| Compound Name | methyl N-[[(2E)-2-(4-chlorophenyl)-2-(phenylhydrazinylidene)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 100965290 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl N-[[(2E)-2-(4-chlorophenyl)-2-(phenylhydrazinylidene)acetyl]amino]carbamate |
| SMILES | COC(=O)NNC(=O)/C(=N/Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4O3/c1-24-16(23)21-20-15(22)14(11-7-9-12(17)10-8-11)19-18-13-5-3-2-4-6-13/h2-10,18H,1H3,(H,20,22)(H,21,23)/b19-14+ |
| InChIKey | RSMBWGVNNUGJMI-XMHGGMMESA-N |
| XLogP | 2.54 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|