C12H16BrNO4 — CID 100965499
ethyl N-[2-(3-bromo-1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate (PubChem CID 100965499) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is ethyl N-[2-(3-bromo-1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate.
| Compound Name | ethyl N-[2-(3-bromo-1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 100965499 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | ethyl N-[2-(3-bromo-1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate |
| SMILES | CCOC(=O)NCCC1(OC)C=CC(=O)C(Br)=C1 |
| InChI | InChI=1S/C12H16BrNO4/c1-3-18-11(16)14-7-6-12(17-2)5-4-10(15)9(13)8-12/h4-5,8H,3,6-7H2,1-2H3,(H,14,16) |
| InChIKey | FTQWXZFWYJHBPE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|