C31H54O9Si — CID 100966097
1-O,1-O-diethyl 9-O-methyl (4Z,8S,9S,10E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-5-methyltetradeca-4,10,12-triene-1,1,9-tricarboxylate (PubChem CID 100966097) has the molecular formula C31H54O9Si and a molecular weight of 598.85 g/mol. Its IUPAC name is 1-O,1-O-diethyl 9-O-methyl (4Z,8S,9S,10E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-5-methyltetradeca-4,10,12-triene-1,1,9-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 9-O-methyl (4Z,8S,9S,10E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-5-methyltetradeca-4,10,12-triene-1,1,9-tricarboxylate |
|---|---|
| PubChem CID | 100966097 |
| Molecular Formula | C31H54O9Si |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 1-O,1-O-diethyl 9-O-methyl (4Z,8S,9S,10E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-5-methyltetradeca-4,10,12-triene-1,1,9-tricarboxylate |
| SMILES | CCOC(=O)C(CC/C=C(/C)CC[C@H](OCOC)[C@H](/C=C/C=C/CO[Si](C)(C)C(C)(C)C)C(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C31H54O9Si/c1-11-37-29(33)26(30(34)38-12-2)19-16-17-24(3)20-21-27(39-23-35-7)25(28(32)36-8)18-14-13-15-22-40-41(9,10)31(4,5)6/h13-15,17-18,25-27H,11-12,16,19-23H2,1-10H3/b15-13+,18-14+,24-17-/t25-,27-/m0/s1 |
| InChIKey | COKPQQCGDVAEJJ-LJJJPZLESA-N |
| XLogP | 6.15 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|