C17H27NO14S3 — CID 100966171
diethyl 2-[[(1R,2R,3S,4S,5R)-2,3,4-tris(methylsulfonyloxy)-8-oxa-6-azabicyclo[3.2.1]octan-6-yl]methylidene]propanedioate (PubChem CID 100966171) has the molecular formula C17H27NO14S3 and a molecular weight of 565.60 g/mol. Its IUPAC name is diethyl 2-[[(1R,2R,3S,4S,5R)-2,3,4-tris(methylsulfonyloxy)-8-oxa-6-azabicyclo[3.2.1]octan-6-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(1R,2R,3S,4S,5R)-2,3,4-tris(methylsulfonyloxy)-8-oxa-6-azabicyclo[3.2.1]octan-6-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 100966171 |
| Molecular Formula | C17H27NO14S3 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | diethyl 2-[[(1R,2R,3S,4S,5R)-2,3,4-tris(methylsulfonyloxy)-8-oxa-6-azabicyclo[3.2.1]octan-6-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1C[C@H]2O[C@@H]1[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@@H]2OS(C)(=O)=O)C(=O)OCC |
| InChI | InChI=1S/C17H27NO14S3/c1-6-27-16(19)10(17(20)28-7-2)8-18-9-11-12(30-33(3,21)22)13(31-34(4,23)24)14(15(18)29-11)32-35(5,25)26/h8,11-15H,6-7,9H2,1-5H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | LDMMYKAXTRQSKS-NIFZNCRKSA-N |
| XLogP | -1.93 |
| TPSA | 195.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|