C25H13F2NO9 — CID 100966249
4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoic acid (PubChem CID 100966249) has the molecular formula C25H13F2NO9 and a molecular weight of 509.37 g/mol. Its IUPAC name is 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoic acid.
| Compound Name | 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 100966249 |
| Molecular Formula | C25H13F2NO9 |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3cc(F)c(=O)cc-3oc3cc(O)c(F)cc23)c(C(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C25H13F2NO9/c26-15-6-13-19(8-17(15)29)36-20-9-18(30)16(27)7-14(20)23(13)11-2-1-10(24(33)34)5-12(11)25(35)37-28-21(31)3-4-22(28)32/h1-2,5-9,29H,3-4H2,(H,33,34) |
| InChIKey | LDCWKBVGRGRABU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|