C23H19F2N7OS — CID 10096647
2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-quinolin-3-yl-1,2,4-triazole-3-thione (PubChem CID 10096647) has the molecular formula C23H19F2N7OS and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-quinolin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-quinolin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10096647 |
| Molecular Formula | C23H19F2N7OS |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-quinolin-3-yl-1,2,4-triazole-3-thione |
| SMILES | C[C@@H](n1ncn(-c2cnc3ccccc3c2)c1=S)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H19F2N7OS/c1-15(23(33,11-30-13-26-12-28-30)19-7-6-17(24)9-20(19)25)32-22(34)31(14-29-32)18-8-16-4-2-3-5-21(16)27-10-18/h2-10,12-15,33H,11H2,1H3/t15-,23-/m1/s1 |
| InChIKey | TXTKOOJIIZTXLK-IQMFZBJNSA-N |
| XLogP | 3.97 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|