C29H24N2O5 — CID 100966512
8-(3-methoxybenzoyl)-4,9-diphenyl-4,8-diazatricyclo[5.2.2.02,6]undecane-3,5,10-trione (PubChem CID 100966512) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 8-(3-methoxybenzoyl)-4,9-diphenyl-4,8-diazatricyclo[5.2.2.02,6]undecane-3,5,10-trione.
| Compound Name | 8-(3-methoxybenzoyl)-4,9-diphenyl-4,8-diazatricyclo[5.2.2.02,6]undecane-3,5,10-trione |
|---|---|
| PubChem CID | 100966512 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 8-(3-methoxybenzoyl)-4,9-diphenyl-4,8-diazatricyclo[5.2.2.02,6]undecane-3,5,10-trione |
| SMILES | COc1cccc(C(=O)N2C3CC(=O)C(C4C(=O)N(c5ccccc5)C(=O)C43)C2c2ccccc2)c1 |
| InChI | InChI=1S/C29H24N2O5/c1-36-20-14-8-11-18(15-20)27(33)31-21-16-22(32)24(26(31)17-9-4-2-5-10-17)25-23(21)28(34)30(29(25)35)19-12-6-3-7-13-19/h2-15,21,23-26H,16H2,1H3 |
| InChIKey | YLWQSPIUPMDTOZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|