C23H30OS — CID 100966524
(1S,5S,8S,11R)-11-ethenyl-8-[(E)-5-phenylsulfanylpent-3-enyl]-2-oxatricyclo[6.3.0.01,5]undecane (PubChem CID 100966524) has the molecular formula C23H30OS and a molecular weight of 354.56 g/mol. Its IUPAC name is (1S,5S,8S,11R)-11-ethenyl-8-[(E)-5-phenylsulfanylpent-3-enyl]-2-oxatricyclo[6.3.0.01,5]undecane.
| Compound Name | (1S,5S,8S,11R)-11-ethenyl-8-[(E)-5-phenylsulfanylpent-3-enyl]-2-oxatricyclo[6.3.0.01,5]undecane |
|---|---|
| PubChem CID | 100966524 |
| Molecular Formula | C23H30OS |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1S,5S,8S,11R)-11-ethenyl-8-[(E)-5-phenylsulfanylpent-3-enyl]-2-oxatricyclo[6.3.0.01,5]undecane |
| SMILES | C=C[C@H]1CC[C@]2(CC/C=C/CSc3ccccc3)CC[C@H]3CCO[C@@]312 |
| InChI | InChI=1S/C23H30OS/c1-2-19-11-15-22(16-12-20-13-17-24-23(19,20)22)14-7-4-8-18-25-21-9-5-3-6-10-21/h2-6,8-10,19-20H,1,7,11-18H2/b8-4+/t19-,20-,22+,23+/m0/s1 |
| InChIKey | NYDBJMIHNXRYLF-WYDNTBFBSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|