C21H28OS — CID 100966531
(3aS,6aR)-3-ethenyl-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol (PubChem CID 100966531) has the molecular formula C21H28OS and a molecular weight of 328.52 g/mol. Its IUPAC name is (3aS,6aR)-3-ethenyl-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol.
| Compound Name | (3aS,6aR)-3-ethenyl-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol |
|---|---|
| PubChem CID | 100966531 |
| Molecular Formula | C21H28OS |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3aS,6aR)-3-ethenyl-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol |
| SMILES | C=CC1CC[C@]2(CC/C=C/CSc3ccccc3)CCC[C@]12O |
| InChI | InChI=1S/C21H28OS/c1-2-18-12-16-20(14-9-15-21(18,20)22)13-7-4-8-17-23-19-10-5-3-6-11-19/h2-6,8,10-11,18,22H,1,7,9,12-17H2/b8-4+/t18?,20-,21-/m0/s1 |
| InChIKey | XYVGJKAAEXUPIU-GKFZTXSVSA-N |
| XLogP | 5.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|