C18H19N3O5 — CID 100966642
3-[[(2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoyl]amino]benzoic acid (PubChem CID 100966642) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-[[(2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoyl]amino]benzoic acid.
| Compound Name | 3-[[(2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 100966642 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[[(2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoyl]amino]benzoic acid |
| SMILES | N[C@H](CNC(=O)OCc1ccccc1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H19N3O5/c19-15(10-20-18(25)26-11-12-5-2-1-3-6-12)16(22)21-14-8-4-7-13(9-14)17(23)24/h1-9,15H,10-11,19H2,(H,20,25)(H,21,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | KRUYOESTHLEBGX-OAHLLOKOSA-N |
| XLogP | 1.58 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |