C16H22BrNO3S — CID 100966904
(E,2R,3S)-2-bromo-1-(10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl)-3-hydroxyhex-4-en-1-one (PubChem CID 100966904) has the molecular formula C16H22BrNO3S and a molecular weight of 388.33 g/mol. Its IUPAC name is (E,2R,3S)-2-bromo-1-(10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl)-3-hydroxyhex-4-en-1-one.
| Compound Name | (E,2R,3S)-2-bromo-1-(10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl)-3-hydroxyhex-4-en-1-one |
|---|---|
| PubChem CID | 100966904 |
| Molecular Formula | C16H22BrNO3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (E,2R,3S)-2-bromo-1-(10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl)-3-hydroxyhex-4-en-1-one |
| SMILES | C/C=C/[C@H](O)[C@@H](Br)C(=O)N1C(=S)OC2CC3CCC21C3(C)C |
| InChI | InChI=1S/C16H22BrNO3S/c1-4-5-10(19)12(17)13(20)18-14(22)21-11-8-9-6-7-16(11,18)15(9,2)3/h4-5,9-12,19H,6-8H2,1-3H3/b5-4+/t9?,10-,11?,12+,16?/m0/s1 |
| InChIKey | HZQNHXVKABKHHS-CMFZQLRUSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|