C44H52F2N4O6 — CID 100967196
5-[3,5-bis[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-1-N,3-N-bis(6-hydroxyhexyl)benzene-1,3-dicarboxamide (PubChem CID 100967196) has the molecular formula C44H52F2N4O6 and a molecular weight of 770.92 g/mol. Its IUPAC name is 5-[3,5-bis[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-1-N,3-N-bis(6-hydroxyhexyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-[3,5-bis[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-1-N,3-N-bis(6-hydroxyhexyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 100967196 |
| Molecular Formula | C44H52F2N4O6 |
| Molecular Weight | 770.92 g/mol |
| Exact Mass | 770.39 |
| IUPAC Name | 5-[3,5-bis[2-(4-fluorophenyl)ethylcarbamoyl]phenyl]-1-N,3-N-bis(6-hydroxyhexyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCCCCCO)c1cc(C(=O)NCCCCCCO)cc(-c2cc(C(=O)NCCc3ccc(F)cc3)cc(C(=O)NCCc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C44H52F2N4O6/c45-39-13-9-31(10-14-39)17-21-49-43(55)37-27-34(28-38(30-37)44(56)50-22-18-32-11-15-40(46)16-12-32)33-25-35(41(53)47-19-5-1-3-7-23-51)29-36(26-33)42(54)48-20-6-2-4-8-24-52/h9-16,25-30,51-52H,1-8,17-24H2,(H,47,53)(H,48,54)(H,49,55)(H,50,56) |
| InChIKey | ZQUUBNDLXBJTGF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.92 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|