About [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane
[(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane (PubChem CID 100967835) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane.
Molecular Properties
| Compound Name | [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane |
| PubChem CID | 100967835 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane |
| SMILES | C#C/C(=C(/C#C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H24/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h1-2,15-16H,5-14H2/b18-17+ |
| InChIKey | JQKMGHVRUAGBLJ-ISLYRVAYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane?
The IUPAC name of [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane (CID 100967835) is [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane.
What is the SMILES notation for [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane?
The canonical SMILES for [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane is C#C/C(=C(/C#C)C1CCCCC1)C1CCCCC1.
What is the InChIKey of [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane?
The InChIKey is JQKMGHVRUAGBLJ-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H24/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h1-2,15-16H,5-14H2/b18-17+.
What are the key properties of [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane?
[(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane has a molecular weight of 240.39 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-cyclohexylhex-3-en-1,5-diyn-3-yl]cyclohexane is sourced from PubChem (CID 100967835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).