C8H10O4 — CID 100967847
(1R,2R,6S,7R)-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one (PubChem CID 100967847) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (1R,2R,6S,7R)-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one.
| Compound Name | (1R,2R,6S,7R)-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one |
|---|---|
| PubChem CID | 100967847 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1R,2R,6S,7R)-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one |
| SMILES | O=C1OC[C@H]2C[C@@H]1[C@@H]1OCO[C@H]21 |
| InChI | InChI=1S/C8H10O4/c9-8-5-1-4(2-10-8)6-7(5)12-3-11-6/h4-7H,1-3H2/t4-,5-,6-,7+/m1/s1 |
| InChIKey | JXOBUUCIFKYZPA-GBNDHIKLSA-N |
| XLogP | -0.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |