C22H30N2O4S — CID 100967929
(2S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-(phenylmethoxyamino)pent-4-en-1-one (PubChem CID 100967929) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is (2S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-(phenylmethoxyamino)pent-4-en-1-one.
| Compound Name | (2S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-(phenylmethoxyamino)pent-4-en-1-one |
|---|---|
| PubChem CID | 100967929 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-(phenylmethoxyamino)pent-4-en-1-one |
| SMILES | C=CC[C@H](NOCc1ccccc1)C(=O)N1C2CC3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C22H30N2O4S/c1-4-8-18(23-28-14-16-9-6-5-7-10-16)20(25)24-19-13-17-11-12-22(19,21(17,2)3)15-29(24,26)27/h4-7,9-10,17-19,23H,1,8,11-15H2,2-3H3/t17?,18-,19?,22?/m0/s1 |
| InChIKey | NZQYWEDDXPMHOX-ZEVNHLFTSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|