C7H12O — CID 100967958
5,5-dimethylcyclopenten-1-ol (PubChem CID 100967958) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is 5,5-dimethylcyclopenten-1-ol.
| Compound Name | 5,5-dimethylcyclopenten-1-ol |
|---|---|
| PubChem CID | 100967958 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 5,5-dimethylcyclopenten-1-ol |
| SMILES | CC1(C)CCC=C1O |
| InChI | InChI=1S/C7H12O/c1-7(2)5-3-4-6(7)8/h4,8H,3,5H2,1-2H3 |
| InChIKey | IZJAQYGDSRIJBB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |