C33H45N5O8 — CID 100968111
(4S,4aS,5aR,12aR)-9-[[2-(cyclooctylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 100968111) has the molecular formula C33H45N5O8 and a molecular weight of 639.75 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[[2-(cyclooctylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[[2-(cyclooctylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 100968111 |
| Molecular Formula | C33H45N5O8 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[[2-(cyclooctylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)CNC2CCCCCCC2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C33H45N5O8/c1-37(2)21-14-20(36-22(39)15-35-17-10-8-6-5-7-9-11-17)27(40)24-18(21)12-16-13-19-26(38(3)4)29(42)25(32(34)45)31(44)33(19,46)30(43)23(16)28(24)41/h14,16-17,19,26,35,40-41,44,46H,5-13,15H2,1-4H3,(H2,34,45)(H,36,39)/t16-,19-,26-,33-/m0/s1 |
| InChIKey | SKZPCWNJKRNOCJ-WNBQKGBASA-N |
| XLogP | 1.67 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|