C19H22O2Si — CID 100968422
5-(4-methoxyphenyl)-7-trimethylsilyl-2,3-dihydroinden-1-one (PubChem CID 100968422) has the molecular formula C19H22O2Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-7-trimethylsilyl-2,3-dihydroinden-1-one.
| Compound Name | 5-(4-methoxyphenyl)-7-trimethylsilyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 100968422 |
| Molecular Formula | C19H22O2Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-7-trimethylsilyl-2,3-dihydroinden-1-one |
| SMILES | COc1ccc(-c2cc3c(c([Si](C)(C)C)c2)C(=O)CC3)cc1 |
| InChI | InChI=1S/C19H22O2Si/c1-21-16-8-5-13(6-9-16)15-11-14-7-10-17(20)19(14)18(12-15)22(2,3)4/h5-6,8-9,11-12H,7,10H2,1-4H3 |
| InChIKey | SCUCLLFKCSMUGE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|